CAS 255-17-4
:1,4-Benzothiazine
Description:
1,4-Benzothiazine is a heterocyclic compound characterized by a fused benzene and thiazine ring system. It typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the benzene ring. The thiazine portion contributes to its unique chemical reactivity, particularly in nucleophilic and electrophilic substitution reactions. This compound is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structure allows for various substitutions, which can modify its chemical behavior and enhance its pharmacological effects. Additionally, 1,4-benzothiazine derivatives are of interest in medicinal chemistry for their potential applications in drug development. The compound is generally soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and pH. Safety data indicates that, like many organic compounds, it should be handled with care to avoid exposure, as it may pose health risks if ingested or inhaled.
Formula:C8H7NS
InChI:InChI=1S/C8H7NS/c1-2-4-8-7(3-1)9-5-6-10-8/h1-5H,6H2
InChI key:InChIKey=FBOSKQVOIHEWAX-UHFFFAOYSA-N
SMILES:C1=2C(SCC=N1)=CC=CC2
Synonyms:- 1,4-Benzothiazine
- 2H-1,4-Benzothiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
