CymitQuimica logo

CAS 255064-08-5

:

6-bromo-1H-benzimidazole-4-carboxylic acid

Description:
6-Bromo-1H-benzimidazole-4-carboxylic acid is a heterocyclic organic compound characterized by its benzimidazole core, which features a bromine substituent at the 6-position and a carboxylic acid group at the 4-position. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid group, while its aromatic structure contributes to its stability and potential for π-π stacking interactions. The bromine atom introduces a halogen functionality, which can enhance reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many benzimidazole derivatives, it may also possess properties such as antimicrobial or antifungal activity, although specific biological effects would require further investigation. Overall, 6-bromo-1H-benzimidazole-4-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-4-1-5(8(12)13)7-6(2-4)10-3-11-7/h1-3H,(H,10,11)(H,12,13)
InChI key:UPXJWWRKIMKJCY-UHFFFAOYSA-N
SMILES:c1c(cc2c(c1C(=O)O)[nH]cn2)Br
Synonyms:
  • 1H-benzimidazole-4-carboxylic acid, 6-bromo-
  • 6-Bromo-1H-benzimidazole-4-carboxylic acid
  • 1H-Benzimidazole-7-carboxylic acid, 5-bromo-
  • 6-BROMO-1H-BENZOIMIDAZOLE-4-CARBOXYLIC ACID
  • 5-bromo-1H-benzo[d]imidazole-7-carboxylic acid
  • 6-BroMo-1H-benzo[d]iMidazole-4-carboxylic acid
  • 6-broMo-1H-1,3-benzodiazole-4-carboxylic acid
Found 4 products.