CAS 255064-10-9

6-bromo-4-methyl-1H-benzimidazole

Description:

6-Bromo-4-methyl-1H-benzimidazole is a heterocyclic organic compound characterized by its fused benzene and imidazole rings. The presence of a bromine atom at the 6-position and a methyl group at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic structure. It is often used in pharmaceutical research and development due to its potential biological activity, including antimicrobial and anticancer properties. The presence of the bromine atom can enhance its reactivity and influence its interaction with biological targets. Additionally, 6-bromo-4-methyl-1H-benzimidazole can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry fields.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-5-2-6(9)3-7-8(5)11-4-10-7/h2-4H,1H3,(H,10,11)

SMILES: Cc1cc(cc2c1[nH]cn2)Br

5-Bromo-7-methyl-1H-benzimidazole

CAS: 255064-10-9

Formula: C₈H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 211.0586

Ref: IN-DA00384Y

5-Bromo-7-methyl-1H-benzo[d]imidazole

CAS: 255064-10-9

5-Bromo-7-methyl-1H-benzo[d]imidazole

Purity: 98%

Molecular weight: 211.06g/mol

Ref: 54-OR73761

6-Bromo-4-methyl-1H-benzo[d]imidazole

CAS: 255064-10-9

Formula: C₈H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 211.062

Ref: 10-F240519

6-Bromo-4-methyl-1H-benzo[d]imidazole

CAS: 255064-10-9

Versatile small molecule scaffold

Formula: C₈H₇BrN₂

Purity: Min. 95%

Molecular weight: 211.06 g/mol

Ref: 3D-FKA06410