
CAS 25510-99-0
:Cyclobutane, 1,1,2,2,3,3,4,4-octafluoro-, homopolymer
Description:
Cyclobutane, 1,1,2,2,3,3,4,4-octafluoro-, homopolymer, identified by CAS number 25510-99-0, is a fluorinated polymer characterized by its unique structure derived from cyclobutane units fully substituted with fluorine atoms. This polymer exhibits high thermal stability and chemical resistance, making it suitable for various applications in demanding environments. The presence of fluorine atoms imparts low surface energy, contributing to its non-stick properties and resistance to solvents, oils, and chemicals. Additionally, the polymer is typically characterized by its low flammability and excellent electrical insulating properties. Its mechanical properties can vary based on molecular weight and processing conditions, but it generally maintains good flexibility and toughness. Due to these characteristics, this homopolymer finds applications in coatings, sealants, and other materials where durability and resistance to harsh conditions are essential. However, handling and disposal must be approached with caution due to environmental concerns associated with fluorinated compounds.
Formula:(C4F8)x
InChI:InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10
InChI key:InChIKey=BCCOBQSFUDVTJQ-UHFFFAOYSA-N
SMILES:FC1(F)C(F)(F)C(F)(F)C1(F)F
Synonyms:- Cyclobutane, 1,1,2,2,3,3,4,4-octafluoro-, homopolymer
- Cyclobutane, octafluoro-, polymers
- Poly(perfluorocyclobutane)
- Polyoctafluorocyclobutane
- Cyclobutane, octafluoro-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
