CAS 25513-64-8
:Trimethylhexamethylenediamine
Description:
Trimethylhexamethylenediamine, with the CAS number 25513-64-8, is an organic compound that belongs to the class of aliphatic amines. It is characterized by the presence of two amine functional groups and a long hydrocarbon chain, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a strong amine odor. It is soluble in water and various organic solvents, making it versatile for different applications. Trimethylhexamethylenediamine is primarily used as a hardener in epoxy resins and as a curing agent in the production of coatings, adhesives, and sealants. Its chemical structure allows for effective cross-linking, enhancing the mechanical properties of the final products. Additionally, it exhibits moderate toxicity and should be handled with care, following appropriate safety guidelines to minimize exposure. Overall, its combination of reactivity and solubility makes it a valuable compound in industrial applications.
Formula:C9H22N2
InChI:InChI=1/2C9H22N2/c1-8(7-11)6-9(2,3)4-5-10;1-8(4-5-10)6-9(2,3)7-11/h2*8H,4-7,10-11H2,1-3H3
SMILES:CC(CC(C)(C)CCN)CN.CC(CCN)CC(C)(C)CN
Synonyms:- 1,6-Hexanediamine, 2,2,4(or 2,4,4)-trimethyl-
- 2,2,4(or 2,4,4)-Trimethyl-1,6-hexanediamine
- 2,2,4(or 2,4,4)-Trimethylhexamethylenediamine
- 2,2,4-Trimethylhexane-1,6-Diamine
- Aradur 21
- Trimethylhexamethylenediamine
- Trimethylhexamethylenediamine (2,2,4- and 2,4,4- mixtures)
- Vestamin TMD
- TMD
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Trimethylhexamethylenediamine (2,2,4- and 2,4,4- mixture)
CAS:Formula:C9H22N2Purity:>99.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:158.292,2,4(or 2,4,4)-Trimethyl-1,6-hexanediamine
CAS:<p>2,2,4(or 2,4,4)-Trimethyl-1,6-hexanediamine is a multifunctional crosslinker that has been shown to have catalytic and crosslinking properties. It can be used as a crosslinker in epoxy resins and polyurethanes. It is also used as a catalyst in the production of polyurethane foam. 2,2,4(or 2,4,4)-Trimethyl-1,6-hexanediamine can be used for multifunctional purposes such as crosslinking and catalytic activities.</p>Formula:C9H22N2Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:158.28 g/mol

