CAS 25515-73-5

3-[(Carboxymethyl)sulfonyl]-L-alanine

Description:

3-[(Carboxymethyl)sulfonyl]-L-alanine, with the CAS number 25515-73-5, is an amino acid derivative characterized by the presence of a carboxymethylsulfonyl group attached to the L-alanine backbone. This compound features both an amino group and a carboxylic acid group, typical of amino acids, which allows it to participate in various biochemical reactions. The sulfonyl group contributes to its unique properties, potentially enhancing solubility in aqueous environments and influencing its reactivity. This compound may play a role in biochemical pathways, particularly in the synthesis of peptides or as a building block in the development of pharmaceuticals. Its structural characteristics suggest it could interact with biological systems, possibly serving as a ligand or modulator in enzymatic reactions. Additionally, the presence of the sulfonyl group may impart specific functional properties, such as increased stability or altered pKa values, which can affect its behavior in biological contexts. Overall, 3-[(Carboxymethyl)sulfonyl]-L-alanine is a versatile compound with potential applications in biochemistry and medicinal chemistry.

Formula: C₅H₉NO₆S

InChI: InChI=1S/C5H9NO6S/c6-3(5(9)10)1-13(11,12)2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1

InChI key: InChIKey=PSVSDDKFFZCXRC-VKHMYHEASA-N

SMILES: S(C[C@@H](C(O)=O)N)(CC(O)=O)(=O)=O

Synonyms:

• 3-[(Carboxymethyl)sulfonyl]-L-alanine
• (2R)-2-Amino-3-(carboxymethanesulfonyl)propanoic acid
• L-Alanine, 3-[(carboxymethyl)sulfonyl]-
• Alanine, 3-[(carboxymethyl)sulfonyl]-, L-

Carbocisteine Impurity 8

CAS: 25515-73-5

Formula: C₅H₉NO₆S

Molecular weight: 211.19

Ref: 4Z-C-132014