CymitQuimica logo

CAS 25519-55-5

:

3-methylquinoxaline-2-carbaldehyde

Description:
3-Methylquinoxaline-2-carbaldehyde is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features a methyl group at the 3-position and an aldehyde functional group at the 2-position, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. It typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of the aldehyde group makes it a versatile intermediate for further chemical transformations, such as condensation reactions or as a building block for more complex molecules. Additionally, compounds like 3-methylquinoxaline-2-carbaldehyde are of interest in the development of pharmaceuticals, agrochemicals, and materials science due to their biological activity and ability to interact with various biological targets. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c1-7-10(6-13)12-9-5-3-2-4-8(9)11-7/h2-6H,1H3
SMILES:Cc1c(C=O)nc2ccccc2n1
Synonyms:
  • 2-Quinoxalinecarboxaldehyde, 3-Methyl-
  • Quinoxaline-2-carboxaldehyde, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.