CAS 2552-45-6
:methyl 4-chloro-3,5-dinitrobenzoate
Description:
Methyl 4-chloro-3,5-dinitrobenzoate, with the CAS number 2552-45-6, is an organic compound characterized by its aromatic structure and the presence of multiple functional groups. It features a benzoate moiety with a methyl ester group, which contributes to its solubility in organic solvents. The compound contains two nitro groups and a chlorine atom, which are positioned on the benzene ring, influencing its reactivity and physical properties. Typically, such nitro-substituted compounds exhibit significant electron-withdrawing characteristics, which can affect their chemical behavior, including reactivity in electrophilic substitution reactions. Methyl 4-chloro-3,5-dinitrobenzoate is often used in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. It may also exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C8H5ClN2O6
InChI:InChI=1/C8H5ClN2O6/c1-17-8(12)4-2-5(10(13)14)7(9)6(3-4)11(15)16/h2-3H,1H3
SMILES:COC(=O)c1cc(c(c(c1)N(=O)=O)Cl)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 4-chloro-3,5-dinitro-benzoate
CAS:Methyl 4-chloro-3,5-dinitro-benzoatePurity:≥95%Molecular weight:260.59g/molMethyl 4-chloro-3,5-dinitrobenzoate
CAS:Methyl 4-chloro-3,5-dinitrobenzoate is a photoinduced electron acceptor that can be used to detect the presence of hydroxide ions. It reacts with chlorine and hydroxide ions to produce carbonyl chloride and hydrogen chloride, which react with methylene blue in an exothermic reaction to generate fluorescence. Methyl 4-chloro-3,5-dinitrobenzoate has been shown to react with nucleophiles such as amines, sulfides and phosphines. This reaction provides kinetic data for the kinetics of transfer reactions.Formula:C8H5ClN2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:260.59 g/mol

