CAS 25520-73-4: (αS)-α-Amino-3,4-dioxo-1,5-cyclohexadiene-1-propanoic acid

Description:(αS)-α-Amino-3,4-dioxo-1,5-cyclohexadiene-1-propanoic acid, with CAS number 25520-73-4, is an organic compound characterized by its unique bicyclic structure that includes both amino and dioxo functional groups. This compound features a cyclohexadiene ring system, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amino group indicates that it can participate in various biochemical processes, potentially acting as an intermediate in amino acid metabolism or as a building block for more complex molecules. Its dioxo groups suggest that it may exhibit strong electrophilic properties, making it a candidate for reactions involving nucleophiles. Additionally, the stereochemistry denoted by (αS) indicates a specific spatial arrangement of atoms, which can influence the compound's biological activity and interactions with other molecules. Overall, this compound's structural features suggest it may have relevance in medicinal chemistry or as a synthetic intermediate in the development of pharmaceuticals.

Formula:C₉H₉NO₄

InChI:InChI=1S/C9H9NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6H,3,10H2,(H,13,14)/t6-/m0/s1

InChI key:InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N

SMILES:O=C1C=CC(=CC1=O)CC(N)C(=O)O

Synonyms:
(αS)-α-Amino-3,4-dioxo-1,5-cyclohexadiene-1-propanoic acid
1,5-Cyclohexadiene-1-propanoic acid, α-amino-3,4-dioxo-, (S)-
1,5-Cyclohexadiene-1-propanoic acid, α-amino-3,4-dioxo-, (αS)-
1,5-Cyclohexadiene-1-propanoicacid, a-amino-3,4-dioxo-, (S)-
1,5-Cyclohexadiene-1-propionic acid, a-amino-3,4-dioxo-, L- (8CI)
1,5-Cyclohexadiene-1-propionic acid, α-amino-3,4-dioxo-, <span class="text-smallcaps">L</span>-
<span class="text-smallcaps">L</span>-DOPA semiquinone
Dopaquinone
L-DOPAsemiquinone
1,5-Cyclohexadiene-1-propionic acid, α-amino-3,4-dioxo-, L-
See more synonyms