CAS 25532-79-0
:trans-α-Bisabolene
Description:
Trans-α-Bisabolene is a naturally occurring sesquiterpene hydrocarbon characterized by its distinct structure and properties. It is primarily found in essential oils of various plants, contributing to their aroma and flavor profiles. The compound is known for its pleasant, sweet, and woody scent, making it valuable in the fragrance and flavor industries. Trans-α-Bisabolene has a molecular formula that reflects its composition of carbon and hydrogen atoms, typically exhibiting a low boiling point and moderate volatility. Its chemical structure includes multiple double bonds, which contribute to its reactivity and potential for undergoing various chemical transformations. Additionally, trans-α-Bisabolene may possess biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in the fields of pharmacology and natural product chemistry. As with many terpenes, it is generally considered safe for use in food and cosmetic applications, although specific regulatory guidelines should be followed. Overall, trans-α-Bisabolene is an important compound in both natural and industrial contexts due to its unique characteristics and applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7+
InChI key:InChIKey=YHBUQBJHSRGZNF-VGOFMYFVNA-N
SMILES:C(=C\CC=C(C)C)(\C)/C1CCC(C)=CC1
Synonyms:- (E)-.alpha.-bisabolene
- (E)-a-Bisabolene
- 1-methyl-4-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexene
- 2,5-Heptadiene, 2-methyl-6-(4-methyl-3-cyclohexen-1-yl)-, (E)-
- 4-(1,5-Dimethyl-1,4-hexadienyl)-1-methyl-cyclohexene
- 4-[(1E)-1,5-Dimethyl-1,4-hexadien-1-yl]-1-methylcyclohexene
- Cyclohexene, 4-(1,5-dimethyl-1,4-hexadienyl)-1-methyl-
- Cyclohexene, 4-(1,5-dimethyl-1,4-hexadienyl)-1-methyl-, (E)-
- Cyclohexene, 4-[(1E)-1,5-dimethyl-1,4-hexadienyl]-1-methyl-
- cyclohexene, 4-[(1E)-1,5-dimethyl-1,4-hexadien-1-yl]-1-methyl-
- trans-.alpha.-Bisabolene
- trans-a-Bisabolene
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
