CAS 255393-53-4

1,1,3,3,6-pentamethyl-7-nitro-5-indanamine

Description:

1,1,3,3,6-Pentamethyl-7-nitro-5-indanamine, identified by its CAS number 255393-53-4, is a synthetic organic compound characterized by its complex molecular structure, which includes an indanamine core substituted with multiple methyl groups and a nitro group. This compound typically exhibits properties associated with both amines and nitro compounds, such as potential basicity due to the amine functional group and reactivity due to the presence of the nitro group. The presence of five methyl groups contributes to its hydrophobic character, influencing its solubility in organic solvents rather than in water. Additionally, the compound may exhibit interesting electronic properties due to the nitro group, which can affect its reactivity and interaction with other chemical species. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and material science. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1/C14H20N2O2/c1-8-10(15)6-9-11(12(8)16(17)18)14(4,5)7-13(9,2)3/h6H,7,15H2,1-5H3

SMILES: Cc1c(cc2c(c1N(=O)=O)C(C)(C)CC2(C)C)N

Synonyms:

• 1,1,3,3,6-pentamethyl-7-nitro-2,3-dihydro-1H-inden-5-amine

5-Amino-7-nitro-1,1,3,3,6-pentamethylindane

CAS: 255393-53-4

5-Amino-7-nitro-1,1,3,3,6-pentamethylindane

Purity: ≥95%

Molecular weight: 248.32g/mol

Ref: 54-OR15761