CAS 255395-56-3

8-chloro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid

Description:

8-Chloro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid is a heterocyclic compound characterized by its unique fused ring structure, which includes a thieno and thiochromene moiety. This compound features a chlorine substituent at the 8-position and a carboxylic acid functional group at the 2-position, contributing to its chemical reactivity and potential biological activity. The presence of the thieno and thiochromene rings imparts distinct electronic properties, making it of interest in medicinal chemistry and material science. The compound is likely to exhibit moderate solubility in organic solvents, while its carboxylic acid group can engage in hydrogen bonding, influencing its interactions in biological systems. Additionally, the chlorine atom may enhance lipophilicity and affect the compound's pharmacokinetic properties. Overall, 8-chloro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid represents a complex structure with potential applications in drug development and research.

Formula: C₁₂H₇ClO₂S₂

InChI: InChI=1/C12H7ClO2S2/c13-7-1-2-9-8(4-7)11-6(5-16-9)3-10(17-11)12(14)15/h1-4H,5H2,(H,14,15)

SMILES: c1cc2c(cc1Cl)c1c(cc(C(=O)O)s1)CS2

Synonyms:

• 8-chloro-4H-benzo[b]thieno[2,3-d]thiine-2-carboxylic acid

8-Chloro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid

CAS: 255395-56-3

8-Chloro-4H-thieno[3,2-c]thiochromene-2-carboxylic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 282.77g/mol

Ref: 54-OR111468