CAS 2554-84-9
:2-(2,3-dimethoxyphenyl)-4H-chromen-4-one
Description:
2-(2,3-Dimethoxyphenyl)-4H-chromen-4-one, also known by its CAS number 2554-84-9, is a synthetic organic compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromone backbone, characterized by a benzopyran structure, which is fused to a phenyl group that has two methoxy substituents at the 2 and 3 positions. The presence of these methoxy groups enhances its solubility and may influence its biological activity. Typically, compounds of this class exhibit a range of pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer activities. The molecular structure contributes to its ability to interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-(2,3-dimethoxyphenyl)-4H-chromen-4-one represents a significant compound for research in both organic synthesis and pharmacology.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-19-15-9-5-7-12(17(15)20-2)16-10-13(18)11-6-3-4-8-14(11)21-16/h3-10H,1-2H3
Synonyms:- 2554-84-9
- 2-(2,3-Dimethoxyphenyl)-4H-chromen-4-one
- 2',3'-Dimethoxyflavone
- 4H-1-Benzopyran-4-one, 2-(2,3-dimethoxyphenyl)-
- 2-(2,3-dimethoxyphenyl)chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2',3'-Dimethoxyflavone
CAS:2',3'-Dimethoxyflavone is a synthetic flavone derivative, which is naturally sourced from plants, particularly those containing flavonoid compounds. Its mode of action involves modulating various biochemical pathways, including enzyme inhibition and interaction with cellular receptors. This modulation can alter cell signaling, affecting processes such as inflammation and cancer cell proliferation.Formula:C17H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:282.29 g/mol
