CAS 25543-68-4

1,5-dihydroxynaphthalene-2,6-dicarboxylic acid

Description:

1,5-Dihydroxynaphthalene-2,6-dicarboxylic acid, with the CAS number 25543-68-4, is an organic compound characterized by its naphthalene backbone, which features two hydroxyl groups and two carboxylic acid groups. This compound is a derivative of naphthalene, a polycyclic aromatic hydrocarbon, and exhibits properties typical of both phenolic and carboxylic acid functionalities. The presence of hydroxyl groups contributes to its potential solubility in polar solvents and its ability to form hydrogen bonds, while the carboxylic acid groups can participate in acid-base reactions and contribute to the compound's acidity. This compound may be utilized in various applications, including as a building block in organic synthesis, in the production of dyes, or as a potential intermediate in the synthesis of more complex chemical entities. Its structural features suggest it may also exhibit interesting electronic properties, making it a candidate for research in materials science and organic electronics.

Formula: C₁₂H₈O₆

InChI: InChI=1/C12H8O6/c13-9-5-1-3-7(11(15)16)10(14)6(5)2-4-8(9)12(17)18/h1-4,13-14H,(H,15,16)(H,17,18)

SMILES: c1cc(c(c2ccc(c(c12)O)C(=O)O)O)C(=O)O

1,5-Dihydroxynaphthalene-2,6-dicarboxylic acid

CAS: 25543-68-4

1,5-Dihydroxynaphthalene-2,6-dicarboxylic acid

Purity: 95%

Molecular weight: 248.19g/mol

Ref: 54-OR1066865

1,5-Dihydroxynaphthalene-2,6-dicarboxylic Acid

Controlled Product

CAS: 25543-68-4

Applications 1,5-dihydroxynaphthalene-2,6-dicarboxylic acid (cas# 25543-68-4) is a useful research chemical.

Formula: C₁₂H₈O₆

Color and Shape: Neat

Molecular weight: 248.188

Ref: TR-D159531