CAS 25546-02-5
:3-tert-butyl-5-chloro-6-(hydroxymethyl)pyrimidine-2,4(1H,3H)-dione
Description:
3-tert-butyl-5-chloro-6-(hydroxymethyl)pyrimidine-2,4(1H,3H)-dione, with CAS number 25546-02-5, is a chemical compound that belongs to the pyrimidine family, characterized by a pyrimidine ring substituted with various functional groups. This compound features a tert-butyl group, which contributes to its hydrophobic properties, and a chloro substituent that can influence its reactivity and potential biological activity. The presence of a hydroxymethyl group indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The diketone structure (2,4-dione) suggests that it may exhibit tautomerism and can act as a versatile building block in organic synthesis. Additionally, compounds of this type may possess pharmacological properties, making them of interest in medicinal chemistry. Overall, the unique combination of substituents in this molecule contributes to its chemical behavior, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H13ClN2O3
InChI:InChI=1/C9H13ClN2O3/c1-9(2,3)12-7(14)6(10)5(4-13)11-8(12)15/h13H,4H2,1-3H3,(H,11,15)
SMILES:CC(C)(C)n1c(=O)c(c(CO)nc1O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-tert-Butyl-5-chloro-6-hydroxymethyluracil (6-Desmethyl-6-Hydroxymethyl Terbacil)
CAS:Controlled ProductFormula:C9H13ClN2O3Color and Shape:White To Off-WhiteMolecular weight:232.6641

