CAS 25554-21-6

(2Z)-2-cyano-3-[4-(propan-2-yl)phenyl]prop-2-enoic acid

Description:

(2Z)-2-cyano-3-[4-(propan-2-yl)phenyl]prop-2-enoic acid, with CAS number 25554-21-6, is an organic compound characterized by its unique structural features. It contains a cyano group (-CN) and a prop-2-enoic acid moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the isopropyl-substituted phenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound typically exhibits a conjugated double bond system, which can lead to interesting optical properties and reactivity patterns, particularly in electrophilic addition reactions. Its acidity is attributed to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's structural complexity suggests potential utility in pharmaceuticals or agrochemicals, where such derivatives may serve as intermediates or active ingredients. Overall, (2Z)-2-cyano-3-[4-(propan-2-yl)phenyl]prop-2-enoic acid is a versatile compound with significant implications in synthetic chemistry.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1/C13H13NO2/c1-9(2)11-5-3-10(4-6-11)7-12(8-14)13(15)16/h3-7,9H,1-2H3,(H,15,16)/b12-7-

SMILES: CC(C)c1ccc(cc1)/C=C(/C#N)\C(=O)O

Synonyms:

• (2Z)-2-Cyano-3-(4-isopropylphenyl)acrylic acid
• 2-propenoic acid, 2-cyano-3-[4-(1-methylethyl)phenyl]-, (2Z)-

(2Z)-2-Cyano-3-(4-isopropylphenyl)acrylic acid

CAS: 25554-21-6

Versatile small molecule scaffold

Formula: C₁₃H₁₃NO₂

Purity: Min. 95%

Molecular weight: 215.25 g/mol

Ref: 3D-ABA55421