CAS 25562-98-5
:2-Phenoxyphenylacetonitrile
Description:
2-Phenoxyphenylacetonitrile, with the CAS number 25562-98-5, is an organic compound characterized by its structure, which includes a phenoxy group and an acetonitrile functional group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. It exhibits properties that make it useful in various chemical applications, including as an intermediate in organic synthesis and potentially in the development of pharmaceuticals. The presence of both the phenoxy and acetonitrile groups contributes to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, 2-Phenoxyphenylacetonitrile may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C14H11NO
InChI:InChI=1/C14H11NO/c15-11-10-12-6-4-5-9-14(12)16-13-7-2-1-3-8-13/h1-9H,10H2
SMILES:c1ccc(cc1)Oc1ccccc1CC#N
Synonyms:- 2-Phenoxybenzyl cyanide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Phenoxyphenyl)acetonitrile
CAS:2-(2-Phenoxyphenyl)acetonitrilePurity:≥95%Color and Shape:Colourless LiquidMolecular weight:209.24g/mol2-Phenoxyphenylacetonitrile
CAS:<p>2-Phenoxyphenylacetonitrile is a pyrethroid n-oxide that is chemically related to other insecticides that are used in agriculture and against insects such as mosquitoes. 2-Phenoxyphenylacetonitrile is a synthetic compound that has been shown to have an optimum pH of 5.5, which makes it difficult to dissolve in water. The compound's high stability at low pH levels means that it can be used in acidic environments. It also has been shown to have strong activity against human serum and food composition, with no detectable activity against bacteria or fungi.</p>Formula:C14H11NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:209.24 g/mol



