CymitQuimica logo

CAS 25563-04-6

:

2-(4-Chloro-phenoxy)-Phenylacetic Acid

Description:
2-(4-Chloro-phenoxy)-Phenylacetic Acid, with the CAS number 25563-04-6, is an organic compound characterized by its phenylacetic acid structure, which features a phenoxy group substituted with a chlorine atom at the para position. This compound typically appears as a white to off-white solid and is known for its potential applications in pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the chloro substituent can influence its reactivity and biological activity, often enhancing its potency in various applications. Additionally, this compound may exhibit properties such as anti-inflammatory or herbicidal activity, making it of interest in medicinal chemistry and agricultural research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-(4-Chloro-phenoxy)-Phenylacetic Acid represents a significant compound in the study of organic chemistry and its applications.
Formula:C14H11ClO3
InChI:InChI=1S/C14H11ClO3/c15-11-5-7-12(8-6-11)18-13-4-2-1-3-10(13)9-14(16)17/h1-8H,9H2,(H,16,17)
InChI key:ALMJMOPIBISVHZ-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)CC(=O)O)OC2=CC=C(C=C2)Cl
Found 6 products.