CAS 25569-53-3
:Ethylene glycol-succinic acid copolymer
Description:
Ethylene glycol-succinic acid copolymer, identified by its CAS number 25569-53-3, is a type of biodegradable polymer that combines the properties of ethylene glycol and succinic acid. This copolymer exhibits a range of characteristics that make it suitable for various applications, particularly in the fields of biomedical engineering and materials science. It is known for its good mechanical strength, flexibility, and thermal stability, which can be tailored through the adjustment of its molecular weight and composition. The copolymer is also hydrophilic, allowing for enhanced water absorption, which can be beneficial in applications such as drug delivery systems and tissue engineering scaffolds. Additionally, its biodegradability is a significant advantage, as it can break down into non-toxic byproducts, making it an environmentally friendly option compared to traditional petroleum-based polymers. Overall, the ethylene glycol-succinic acid copolymer represents a versatile material with potential for innovative uses in sustainable technologies.
Formula:(C4H6O4·C2H6O2)x
InChI:InChI=1S/C4H6O4.C2H6O2/c5-3(6)1-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2
InChI key:InChIKey=VJVOPINBJQWMNY-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C(O)=O.C(CO)O
Synonyms:- 1,2-Ethanediol, polymer with butanedioic acid
- 1,2-Ethanediol-succinic acid copolymer
- 1,4-Butanedioic acid-ethylene glycol copolymer
- Butanedioic acid, polymer with 1,2-ethanediol
- Butanedioic acid-ethylene glycol copolymer
- Ethane-1,2-Diol-Butanedioic Acid (1:1)
- Ethylene glycol succinate
- Ethylene glycol, polyester with succinic acid
- Ethylene glycol-1,4-butanedioic acid copolymer
- Ethylene glycol-succinic acid copolymer
- Ethylene glycol-succinic acid polymer
- Poly(ethylene succinate) monomer based
- Succinic acid, polyester with ethylene glycol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Poly(ethylene Glycol Succinate)
CAS:Formula:C6H12O6Purity:98%Color and Shape:SolidMolecular weight:180.1559Poly(ethylene glycol succinate)
CAS:Controlled ProductPoly(ethylene glycol succinate) (PEG-S) is a biodegradable polymer that has been used to produce membranes for wastewater treatment plants. The PEG-S membrane allows water vapor to pass through while preventing the passage of dissolved solids. X-ray diffraction data and conformational properties have shown that PEG-S is a polymer with hydrogen bonding interactions. Hydroxyl groups on the polymer chain are responsible for the formation of hydrogen bonds, which in turn provide the polymer with hydrophilic properties. PEG-S is synthesized from succinic acid and ethylene oxide, which can be obtained from natural sources such as corn or petroleum products. The process of synthesizing PEG-S involves condensation of succinic acid with ethylene oxide followed by ring opening to form an ester linkage between two polymers chains.Formula:C6H12O6Purity:Min. 95%Molecular weight:180.16 g/mol



