CAS 2557-49-5: Diflorasone
Description:Diflorasone is a synthetic corticosteroid primarily used for its anti-inflammatory and immunosuppressive properties. It is characterized by its potent glucocorticoid activity, making it effective in treating various dermatological conditions, such as eczema and psoriasis. The chemical structure of diflorasone includes fluorine atoms, which enhance its anti-inflammatory efficacy and reduce the risk of systemic side effects compared to other corticosteroids. It is typically formulated as a topical ointment or cream, allowing for localized treatment with minimal systemic absorption. The substance is known for its ability to inhibit the release of inflammatory mediators and modulate immune responses. As with other corticosteroids, prolonged use can lead to potential side effects, including skin thinning and local irritation. Therefore, it is essential to use diflorasone under medical supervision, adhering to prescribed dosages and treatment durations to minimize adverse effects while maximizing therapeutic benefits.
Formula:C22H28F2O5
InChI:InChI=1S/C22H28F2O5/c1-11-6-13-14-8-16(23)15-7-12(26)4-5-19(15,2)21(14,24)17(27)9-20(13,3)22(11,29)18(28)10-25/h4-5,7,11,13-14,16-17,25,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
InChI key:InChIKey=WXURHACBFYSXBI-XHIJKXOTSA-N
SMILES:O=C1C=CC2(C(=C1)C(F)CC3C4CC(C)C(O)(C(=O)CO)C4(C)CC(O)C32F)C
- Synonyms:
- (6Alpha,11Beta,16Beta)-6,9-Difluoro-11,17,21-Trihydroxy-16-Methylpregna-1,4-Diene-3,20-Dione
- (6α,11β,16β)-6,9-Difluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione
- 6alpha,9-Difluoro-11beta,17,21-trihydroxy-16beta-methylpregna-1,4-diene-3,20-dione
- Diflorason
- Diflorasona
- Diflorasona [INN-Spanish]
- Diflorasone [INN:BAN]
- Diflorasonum
- Diflorasonum [INN-Latin]
- Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11,17,21-trihydroxy-16-methyl-, (6α,11β,16β)-
- See more synonyms
- Pregna-1,4-diene-3,20-dione, 6α,9-difluoro-11β,17,21-trihydroxy-16β-methyl-
- Unii-T2Dhj9645W
- Diflorasone
