CAS 2557-70-2

2-(trifluoroacetyl)pyrrole

Description:

2-(Trifluoroacetyl)pyrrole is an organic compound characterized by the presence of a pyrrole ring substituted with a trifluoroacetyl group. The molecular structure features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity due to the electron-withdrawing trifluoroacetyl group, which can influence its behavior in various chemical reactions, including nucleophilic substitutions and condensation reactions. The trifluoroacetyl moiety enhances the compound's polarity and can affect its solubility in different solvents. Additionally, 2-(trifluoroacetyl)pyrrole may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Overall, its unique structure and properties make it a valuable compound in various chemical applications.

Formula: C₆H₄F₃NO

InChI: InChI=1S/C6H4F3NO/c7-6(8,9)5(11)4-2-1-3-10-4/h1-3,10H

SMILES: c1cc(C(=O)C(F)(F)F)[nH]c1

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(1H-pyrrol-2-yl)-

2-(Trifluoroacetyl)pyrrole

CAS: 2557-70-2

Formula: C₆H₄F₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.0973

Ref: IN-DA00BC2Z

2-(Trifluoroacetyl)-1H-pyrrole

CAS: 2557-70-2

2-(Trifluoroacetyl)-1H-pyrrole

Formula: C₆H₄F₃NO

Purity: 99%

Color and Shape: solid

Molecular weight: 163.10g/mol

Ref: 54-PC3389

2-(Trifluoroacetyl)pyrrole

CAS: 2557-70-2

Formula: C₆H₄F₃NO

Purity: 98%

Color and Shape: Crystalline

Molecular weight: 163.099

Ref: 10-F079166