CAS 25574-11-2
:3-(4-Bromophenyl)propan-1-ol
Description:
3-(4-Bromophenyl)propan-1-ol, with the CAS number 25574-11-2, is an organic compound characterized by the presence of a bromophenyl group attached to a propanol chain. This compound features a hydroxyl (-OH) functional group, which classifies it as an alcohol. The bromine atom, located on the para position of the phenyl ring, contributes to the compound's reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which can enhance solubility in polar solvents. The presence of the bromine substituent can also affect the compound's electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Overall, 3-(4-Bromophenyl)propan-1-ol serves as a versatile building block in organic synthesis and materials science.
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7H2
SMILES:C(Cc1ccc(cc1)Br)CO
Synonyms:- 2-(4-Bromophenyl)-1-propanol
- 2-(4-Bromophenyl)propan-1-ol
- Benzeneethanol, 4-bromo-.beta.-methyl-
- 3-(4-Bromo-Phenyl)-Propan-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(4-Bromophenyl)-1-propanol
CAS:Formula:C9H11BrOPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:215.093-(4-Bromophenyl)-1-propanol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H11BrOPurity:98%Molecular weight:215.093-(4-Bromophenyl)propan-1-ol
CAS:Formula:C9H11BrOPurity:96%Color and Shape:LiquidMolecular weight:215.08703-(4-bromophenyl)propan-1-ol
CAS:3-(4-bromophenyl)propan-1-olPurity:98%Color and Shape:SolidMolecular weight:215.09g/mol3-(4-Bromophenyl)propan-1-ol
CAS:Formula:C9H11BrOPurity:96%Color and Shape:LiquidMolecular weight:215.09




