CymitQuimica logo

CAS 255825-38-8

:

2-(1-Oxy-pyridin-2-yl)-1,1,3,3-tetramethylisothiouronium tetrafluoroborate

Description:
2-(1-Oxy-pyridin-2-yl)-1,1,3,3-tetramethylisothiouronium tetrafluoroborate is a chemical compound characterized by its unique structure, which includes a pyridine derivative and a tetramethylisothiouronium moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as high solubility in polar solvents and potential ionic conductivity. The presence of the tetrafluoroborate anion contributes to its stability and solubility in various solvents. It may also display interesting reactivity due to the thiouronium group, which can participate in nucleophilic reactions. The compound is often used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry and materials science. Its specific applications may depend on the functional groups present and the overall molecular architecture, which can influence its reactivity and interaction with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H16BF4N3OS
InChI:InChI=1/C10H16N3OS.BF4/c1-11(2)10(12(3)4)15-9-7-5-6-8-13(9)14;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1
InChI key:LHLFXDQURZVFLK-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.CN(C)C(=[N+](C)C)SC1=CC=CC=[N+]1[O-]
Synonyms:
  • Tott
  • S-(1-Oxo-2-pyridyl)-thio-N,N,N',N'-tetramethyluronium tetrafluoroborate
  • N-{(dimethylamino)[(1-oxidopyridin-2-yl)sulfanyl]methylidene}-N-methylmethanaminium tetrafluoroborate
Found 6 products.