CAS 255893-56-2

1-(2,6-Difluorophenyl)piperazine

Description:

1-(2,6-Difluorophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2,6-difluorophenyl group attached to the piperazine ring significantly influences its chemical properties and biological activity. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. It is often studied for its potential pharmacological applications, particularly in the fields of neuroscience and psychiatry, due to its interactions with various neurotransmitter receptors. The difluorophenyl substituent can enhance lipophilicity and modulate the compound's binding affinity to target receptors. Additionally, the presence of fluorine atoms can affect the compound's metabolic stability and bioavailability. As with many piperazine derivatives, it may exhibit a range of biological activities, making it a subject of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₀H₁₂F₂N₂

InChI: InChI=1S/C10H12F2N2/c11-8-2-1-3-9(12)10(8)14-6-4-13-5-7-14/h1-3,13H,4-7H2

InChI key: InChIKey=YWTWDUFMPFRGJQ-UHFFFAOYSA-N

SMILES: FC1=C(C(F)=CC=C1)N2CCNCC2

Synonyms:

• Piperazine, 1-(2,6-difluorophenyl)-
• 1-(2,6-Difluorophenyl)piperazine
• 1-(2,6-difluorophenyl)piperazine hydrochloride

1-(2,6-Difluorophenyl)piperazine

Controlled Product

CAS: 255893-56-2

Versatile small molecule scaffold

Formula: C₁₀H₁₂F₂N₂

Purity: Min. 95%

Molecular weight: 198.21 g/mol

Ref: 3D-FKA89356