CAS 25615-05-8
:(+)-Catechin 3-gallate
Description:
(+)-Catechin 3-gallate, with the CAS number 25615-05-8, is a flavonoid compound primarily found in various plants, particularly in green tea. It is a type of catechin, which is a class of polyphenols known for their antioxidant properties. This compound is characterized by its ability to scavenge free radicals, thereby contributing to its potential health benefits, including anti-inflammatory and cardioprotective effects. (+)-Catechin 3-gallate is soluble in water and organic solvents, making it versatile for various applications in food, pharmaceuticals, and cosmetics. Its molecular structure includes a catechin backbone with a gallate group, which enhances its biological activity. Research has indicated that this compound may play a role in metabolic regulation and has potential implications in cancer prevention. Additionally, it exhibits antimicrobial properties, which can be beneficial in food preservation and health-related applications. Overall, (+)-Catechin 3-gallate is a significant compound in the study of natural antioxidants and their effects on human health.
Formula:C22H18O10
InChI:InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21+/m0/s1
InChI key:InChIKey=LSHVYAFMTMFKBA-PZJWPPBQSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@@H]2[C@H](OC=3C(C2)=C(O)C=C(O)C3)C4=CC(O)=C(O)C=C4
Synonyms:- Benzoic acid, 3,4,5-trihydroxy-, (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl ester
- Gallic acid, 3-ester with catechol, (+)-
- (+)-Catechin 3-gallate
- Benzoic acid, 3,4,5-trihydroxy-, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl ester, (2R-trans)-
- Catechol, 3-gallate, (+)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Catechin Gallate-13C3
CAS:Controlled ProductFormula:C3C19H18O10Color and Shape:NeatMolecular weight:445.35(+)-Catechin 3-O-gallate
CAS:(+)-Catechin 3-O-gallate is a polyphenolic compound, which is a type of flavonoid. It is found predominantly in tea leaves and other plants, where it acts as a bioactive constituent contributing to the plant's defense mechanism and chemical profile. The mode of action of (+)-Catechin 3-O-gallate involves its ability to act as an antioxidant, neutralizing free radicals and reactive oxygen species, thereby reducing oxidative stress within biological systems.
Formula:C22H18O10Purity:Min. 95%Molecular weight:442.4 g/mol

