CAS 25615-14-9
:4H-1-Benzopyran-4-one,3,7-bis(b-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-
Description:
4H-1-Benzopyran-4-one, 3,7-bis(b-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-, also known by its CAS number 25615-14-9, is a flavonoid compound characterized by its complex glycosylated structure. This substance features a benzopyran core, which is a common structural motif in flavonoids, contributing to its potential biological activities. The presence of multiple hydroxyl groups enhances its antioxidant properties, making it of interest in various health-related studies. The glucopyranosyl moieties suggest that it may exhibit increased solubility in water, which can influence its bioavailability and pharmacokinetics. Additionally, the compound's structure indicates potential interactions with biological targets, such as enzymes or receptors, which could lead to various therapeutic effects. Its unique combination of functional groups may also impart specific reactivity and stability characteristics, making it a subject of interest in both natural product chemistry and pharmaceutical research. Overall, this compound exemplifies the diverse functionalities and potential applications of flavonoids in health and medicine.
Formula:C27H30O16
InChI:InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-5-12(31)16-13(6-11)40-24(9-1-3-10(30)4-2-9)25(19(16)34)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1
InChI key:InChIKey=XFFQVRFGLSBFON-DEFKTLOSSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C2)C4=CC=C(O)C=C4)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O
Synonyms:- 3,7-Bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3,7-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-
- Glucopyranoside, kaempferol-3,7 di-, β-<span class="text-smallcaps">D</span>-
- Glucopyranoside, kaempferol-3,7di-, b-D- (8CI)
- Kaempferol 3,7-di-O-b-D-glucopyranoside
- Kaempferol 3,7-di-O-glucoside
- Kaempferol 3,7-di-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Kaempferol 3,7-di-b-D-glucopyranoside
- Kaempferol 3,7-di-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Kaempferol 3,7-diglucoside
- Kaempferol3,7-di-O-glucoside
- Kaempferol3,7-diglucoside (6CI)
- Kampferol 3,7-diglucoside
- Kampferol3,7-diglucoside
- Paeonoside
- Paeonoside (C27 glycoside)
- Paeonoside (C<sub>27</sub> glycoside)
- Peonoside
- Peonoside (7CI,8CI)
- Glucopyranoside, kaempferol-3,7 di-, β-D-
- 4H-1-Benzopyran-4-one, 3,7-bis(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-
- 3,7-Bis(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 3,7-Bis(β-D-glucopyranosyloxy)-4',5-dihydroxyflavone
- Astragalin 7-O-β-D-glucopyranoside
- Kaempferol-3,7-di-O-β-glucoside
- 3,7-Bis[(β-D-glucopyranosyl)oxy]-4',5-dihydroxyflavone
- 3,7-Di-O-glucosylkaempferol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Kaempferol-3,7-di-O-β-glucoside
CAS:Kaempferol-3,7-di-O-β-glucosidePurity:≥98%Molecular weight:610.52g/molKaempferol-3,7-di-O-β-glucoside
CAS:Kaempferol-3,7-di-O-β-glucoside (Kaempferol 3,7-diglucoside) is a flavonol from Morettia philaena, It can inhibit α-amylase, α-glucosidase andFormula:C27H30O16Purity:99.88%Color and Shape:SolidMolecular weight:610.52Kaempferol -3,7-di-O-glucoside
CAS:<p>Kaempferol-3,7-di-O-glucoside is a naturally occurring flavonoid, which is commonly derived from various plant sources, including fruits, vegetables, and medicinal herbs. As a flavonoid, it appears predominantly in the form of glycosides, where kaempferol is conjugated with sugar moieties, enhancing its solubility and bioavailability.</p>Formula:C27H30O16Purity:Min. 95%Molecular weight:610.52 g/mol



