CAS 25615-16-1
:trans-Zeatin riboside-5′-monophosphate
Description:
Trans-Zeatin riboside-5′-monophosphate is a naturally occurring cytokinin, a class of plant hormones that play a crucial role in regulating various aspects of plant growth and development. This compound is characterized by its riboside structure, which includes a ribose sugar linked to the zeatin base, and a phosphate group at the 5' position. The trans configuration refers to the specific spatial arrangement of the substituents around the double bond in the zeatin moiety, which influences its biological activity. As a monophosphate, it is involved in cellular signaling pathways, promoting cell division and differentiation, and influencing processes such as shoot and root development. Its presence in plant tissues is essential for maintaining growth balance and responding to environmental stimuli. Additionally, trans-Zeatin riboside-5′-monophosphate can be involved in various metabolic pathways, contributing to the overall physiological functions of plants. Its CAS number, 25615-16-1, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases.
Formula:C15H22N5O8P
InChI:InChI=1S/C15H22N5O8P/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(28-15)5-27-29(24,25)26/h2,6-7,9,11-12,15,21-23H,3-5H2,1H3,(H,16,17,18)(H2,24,25,26)/b8-2+/t9-,11-,12-,15-/m1/s1
InChI key:InChIKey=IRILMCCKFANGJQ-HNNGNKQASA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(NC/C=C(/CO)\C)N=CN3)O[C@H](COP(=O)(O)O)[C@H]1O
Synonyms:- N-[(2E)-4-Hydroxy-3-methyl-2-buten-1-yl]-5′-adenylic acid
- 5′-Adenylic acid, N-[(2E)-4-hydroxy-3-methyl-2-butenyl]-
- 5′-Adenylic acid, N-(4-hydroxy-3-methyl-2-butenyl)-, (E)-
- Adenosine, N-(4-hydroxy-3-methyl-2-butenyl)-, 5′-(dihydrogen phosphate), (E)-
- 5′-Adenylic acid, N-[(2E)-4-hydroxy-3-methyl-2-buten-1-yl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
trans-Zeatin riboside-5'-monophosphate sodium salt
CAS:<p>Trans-zeatin riboside-5'-monophosphate sodium salt is a growth rate inhibitor that inhibits protein synthesis by binding to the 30S subunit of the ribosome. This compound has been shown to inhibit cell growth and proliferation in vitro when applied to tissue cultures of tabacum l. and other plants. Trans-zeatin riboside-5'-monophosphate sodium salt is not active against plant tissues grown in vivo, which may be due to its inability to cross the plasma membrane or cell wall.</p>Formula:C15H20N5O8PNa2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:475.3 g/mol
