CAS 25622-74-6
:1-(pentafluorophenyl)propan-1-ol
Description:
1-(Pentafluorophenyl)propan-1-ol is an organic compound characterized by the presence of a pentafluorophenyl group attached to a propan-1-ol moiety. This compound features a hydroxyl (-OH) functional group, which imparts alcohol characteristics, including the ability to engage in hydrogen bonding, influencing its solubility and reactivity. The pentafluorophenyl group, consisting of a phenyl ring with five fluorine atoms, contributes to the compound's unique electronic properties, making it highly lipophilic and potentially altering its reactivity compared to non-fluorinated analogs. The presence of fluorine atoms enhances the compound's stability and can affect its boiling and melting points, as well as its interaction with biological systems. Additionally, the compound may exhibit interesting properties in terms of polarity and hydrophobicity due to the fluorinated substituents. Overall, 1-(pentafluorophenyl)propan-1-ol is of interest in various fields, including materials science and medicinal chemistry, due to its distinctive characteristics and potential applications.
Formula:C9H7F5O
InChI:InChI=1/C9H7F5O/c1-2-3(15)4-5(10)7(12)9(14)8(13)6(4)11/h3,15H,2H2,1H3
SMILES:CCC(c1c(c(c(c(c1F)F)F)F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
