CymitQuimica logo

CAS 2564-00-3

:

2-chloro-N-(4-iodophenyl)acetamide

Description:
2-Chloro-N-(4-iodophenyl)acetamide, with the CAS number 2564-00-3, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent at the second position and an iodophenyl group at the nitrogen atom, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of halogen atoms (chlorine and iodine) in its structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks. Overall, 2-chloro-N-(4-iodophenyl)acetamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural characteristics and potential applications.
Formula:C8H7ClINO
InChI:InChI=1/C8H7ClINO/c9-5-8(12)11-7-3-1-6(10)2-4-7/h1-4H,5H2,(H,11,12)
InChI key:WIUVQCIRRAAPAX-UHFFFAOYSA-N
SMILES:c1cc(ccc1I)NC(=O)CCl
Synonyms:
  • Acetamide, 2-chloro-N-(4-iodophenyl)-
  • N-(4-Iodophenyl) 2-chloroacetamide
  • 2-Chloro-N-(4-iodophenyl)acetamide
Found 3 products.