CAS 2564-05-8

N1-(3-Chlorophenyl)-2-chloroacetamide

Description:

N1-(3-Chlorophenyl)-2-chloroacetamide, with the CAS number 2564-05-8, is an organic compound characterized by its amide functional group. It features a chlorinated aromatic ring, specifically a 3-chlorophenyl group, which contributes to its chemical properties and potential biological activity. The presence of the chloroacetamide moiety suggests that it may exhibit reactivity typical of amides, including potential interactions with nucleophiles. This compound is typically a solid at room temperature and may have moderate solubility in organic solvents, depending on the specific conditions. Its chlorinated structure may impart unique characteristics, such as increased lipophilicity or altered metabolic stability, which can influence its behavior in biological systems. N1-(3-Chlorophenyl)-2-chloroacetamide may be of interest in pharmaceutical research, particularly in the development of compounds with specific therapeutic effects. However, safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose health risks.

Formula: C₈H₇Cl₂NO

InChI: InChI=1/C8H7Cl2NO/c9-5-8(12)11-7-3-1-2-6(10)4-7/h1-4H,5H2,(H,11,12)

SMILES: c1cc(cc(c1)N=C(CCl)O)Cl

Synonyms:

• Acetanilide, 2,3'-dichloro-
• 2-chloro-N-(3-chlorophenyl)acetamide

2-Chloro-N-(3-chlorophenyl)acetamide

CAS: 2564-05-8

Formula: C₈H₇Cl₂NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 204.0533

Ref: IN-DA00BD15

3-Chloro-N-(chloroacetyl)aniline

CAS: 2564-05-8

3-Chloro-N-(chloroacetyl)aniline

Formula: C₈H₇Cl₂NO

Purity: ≥95%

Color and Shape: light brown solid

Molecular weight: 204.05g/mol

Ref: 54-OR3114

2-Chloro-N-(3-chlorophenyl)acetamide

CAS: 2564-05-8

Formula: C₈H₇Cl₂NO

Purity: 95.0%

Molecular weight: 204.05

Ref: 10-F337049