CAS 2564-95-6
:N,N-Dimethylsuccinamic acid
Description:
N,N-Dimethylsuccinamic acid is an organic compound characterized by its amide functional group and a dicarboxylic acid derivative structure. It features two methyl groups attached to the nitrogen atom of the amide, which influences its solubility and reactivity. This compound is typically a white to off-white crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups. N,N-Dimethylsuccinamic acid can participate in various chemical reactions, including acylation and amidation, making it useful in organic synthesis and pharmaceutical applications. Its molecular structure allows for potential interactions with biological systems, which may contribute to its utility in medicinal chemistry. Additionally, it may exhibit properties such as moderate acidity due to the carboxylic acid groups, and its derivatives can be explored for various applications in drug development and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c1-7(2)5(8)3-4-6(9)10/h3-4H2,1-2H3,(H,9,10)
InChI key:InChIKey=WAIGPJMZARQZDX-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(N(C)C)=O
Synonyms:- 4-(Dimethylamino)-4-Oxobutanoate
- 4-(Dimethylamino)-4-Oxobutanoic Acid
- Butanedioic acid mono(N,N-dimethylamide)
- Butanoic acid, 4-(dimethylamino)-4-oxo-
- N,N-Dimethylsuccinamic acid
- N,N-Dimethylsuccinic acid monoamide
- NSC 46778
- Succinamic acid, N,N-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N,N-Dimethylsuccinamic acid, 98%
CAS:It is employed as a intermediate for pharmaceutical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not chFormula:C6H11NO3Purity:98%Molecular weight:145.16N,N-Dimethylsuccinamidic acid
CAS:Formula:C6H11NO3Purity:97%Color and Shape:SolidMolecular weight:145.15644-(Dimethylamino)-4-oxobutanoic acid
CAS:4-(Dimethylamino)-4-oxobutanoic acidPurity:95%Molecular weight:145.16g/mol4-(Dimethylamino)-4-oxobutanoic acid
CAS:Formula:C6H11NO3Purity:97%Color and Shape:SolidMolecular weight:145.158



