CAS 256411-32-2: Camtobell

Description:Camtobell, with the CAS number 256411-32-2, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential applications in cancer treatment. It is classified as a small molecule and is known for its ability to interact with specific biological targets, which may contribute to its therapeutic effects. The compound typically exhibits properties such as moderate solubility in organic solvents and may have a complex structure that includes various functional groups, influencing its reactivity and biological activity. Camtobell's mechanism of action often involves the modulation of cellular pathways, making it a subject of interest in drug development. As with many compounds in this category, its efficacy and safety profile are evaluated through preclinical and clinical studies to determine its potential as a therapeutic agent. Further research is essential to fully understand its characteristics, including pharmacokinetics, pharmacodynamics, and potential side effects.

Formula:C₂₅H₂₇N₃O₄

InChI:InChI=1S/C25H27N3O4/c1-4-25(31)19-11-21-22-17(12-28(21)23(29)18(19)13-32-24(25)30)15(9-10-26-14(2)3)16-7-5-6-8-20(16)27-22/h5-8,11,14,26,31H,4,9-10,12-13H2,1-3H3/t25-/m0/s1

InChI key:InChIKey=LNHWXBUNXOXMRL-VWLOTQADSA-N

SMILES:O=C1OCC=2C(=O)N3C(=CC2C1(O)CC)C=4N=C5C=CC=CC5=C(C4C3)CCNC(C)C

Synonyms:
(4S)-4-Ethyl-4-hydroxy-11-[2-[(1-methylethyl)amino]ethyl]-1H-pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
(4S)-4-ethyl-4-hydroxy-11-{2-[(1-methylethyl)amino]ethyl}-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
(S)-4-Ethyl-4-hydroxy-11-[2-(isopropylamino)ethyl]-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14-dione
1H-Pyrano[3′,4′:6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 4-ethyl-4-hydroxy-11-[2-[(1-methylethyl)amino]ethyl]-, (4S)-
7-[2-(N-Isopropylamino)ethyl]-(20S)-camptothecin
Belotecan

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Belotecan REF: 3D-GKA41132CAS: 256411-32-2	Min. 95%	To inquire	Tue 10 Jun 25
	Belotecan REF: TM-T62435CAS: 256411-32-2	- - -	2,033.00 €~3,345.00 €	Tue 29 Jul 25