CymitQuimica logo

CAS 256411-39-9

:

tert-butyl 4-(cyanomethyl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(cyanomethyl)piperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a tert-butyl group, which enhances its lipophilicity and steric bulk, making it relevant in various synthetic applications. The presence of a cyanomethyl group introduces a nitrile functional group, which can participate in nucleophilic reactions, and the carboxylate moiety contributes to its reactivity and solubility in polar solvents. The compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. Its stability and reactivity can be influenced by factors such as temperature and the presence of other reagents. Safety data should be consulted for handling, as compounds with nitrile groups can pose health risks. Overall, tert-butyl 4-(cyanomethyl)piperidine-1-carboxylate is a versatile building block in organic chemistry.
Formula:C12H20N2O2
InChI:InChI=1/C12H20N2O2/c1-12(2,3)16-11(15)14-8-5-10(4-7-13)6-9-14/h10H,4-6,8-9H2,1-3H3
InChI key:LARQASBBVGBMDA-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC#N)CC1
Synonyms:
  • (1-Boc-piperidin-4-yl)acetonitrile
Found 4 products.