CAS 256414-75-2

5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole

Description:

The chemical substance known as 5-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole, with the CAS number 256414-75-2, is characterized by its complex molecular structure that includes a thiophene ring, an oxadiazole moiety, and multiple trifluoromethyl and phenyl substituents. This compound is likely to exhibit significant electronic properties due to the presence of the trifluoromethyl groups, which are known to enhance lipophilicity and influence the compound's reactivity and stability. The oxadiazole ring contributes to its potential as a heterocyclic compound, which may exhibit interesting biological or pharmacological activities. Additionally, the presence of multiple aromatic systems suggests that this compound may have good light absorption characteristics, making it a candidate for applications in organic electronics or photonic devices. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods such as NMR, mass spectrometry, and UV-Vis spectroscopy.

Formula: C₂₀H₁₀F₆N₂OS

InChI: InChI=1/C20H10F6N2OS/c21-19(22,23)13-8-4-7-12(9-13)17-27-18(29-28-17)15-10-14(11-5-2-1-3-6-11)16(30-15)20(24,25)26/h1-10H

SMILES: c1ccc(cc1)c1cc(c2nc(c3cccc(c3)C(F)(F)F)no2)sc1C(F)(F)F

Synonyms:

• 1,2,4-Oxadiazole, 5-[4-phenyl-5-(trifluoromethyl)-2-thienyl]-3-[3-(trifluoromethyl)phenyl]-
• 5-[4-Phenyl-5-(trifluoromethyl)-2-thienyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole
• 5-[4-Phenyl-5-(Trifluoromethyl)Thien-2-Yl]-3-[3-(Trifluoromethyl)Phenyl]-1,2,4-Oxadiazole

5-[4-Phenyl-5-(trifluoromethyl)-2-thienyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole

CAS: 256414-75-2

Formula: C₂₀H₁₀F₆N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 440.3616

Ref: IN-DA00BDSK

SEW​2871

CAS: 256414-75-2

SEW​2871

Purity: ≥98%

Molecular weight: 440.36g/mol

Ref: 54-BUP01914

SEW2871

CAS: 256414-75-2

SEW2871

Purity: 98%

Molecular weight: 440.36g/mol

Ref: 54-BISN0002

SEW2871

CAS: 256414-75-2

Formula: C₂₀H₁₀F₆N₂OS

Molecular weight: 440.36

Ref: 7W-GL7540

SEW​2871

CAS: 256414-75-2

SEW 2871 is an orally available, highly selective S1P1 agonist. It activates ERK, Akt and Rac signaling pathways and induces S1P1 internalization and recycling.

Formula: C₂₀H₁₀F₆N₂OS

Purity: 99.96%

Color and Shape: White Solid

Molecular weight: 440.36

Ref: TM-T2171

SEW 2871

Controlled Product

CAS: 256414-75-2

Formula: C₂₀H₁₀F₆N₂OS

Color and Shape: Neat

Molecular weight: 440.362

Ref: TR-S282050