CAS 256417-10-4

2,6-Difluoro-4-methoxybenzaldehyde

Description:

2,6-Difluoro-4-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of two fluorine atoms at the 2 and 6 positions of the benzene ring, along with a methoxy group (-OCH3) at the 4 position, contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure allows for potential applications in pharmaceuticals and agrochemicals, particularly due to the influence of the fluorine atoms on reactivity and biological activity. The aldehyde functional group is reactive, making it useful in various chemical synthesis processes, including condensation reactions. Additionally, the methoxy group can enhance the compound's lipophilicity, affecting its interaction with biological systems. Overall, 2,6-Difluoro-4-methoxybenzaldehyde is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₈H₆F₂O₂

InChI: InChI=1/C8H6F2O2/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-4H,1H3

SMILES: COc1cc(c(C=O)c(c1)F)F

Synonyms:

• Vhr Bf Ff Do1

2,6-Difluoro-4-methoxybenzaldehyde

CAS: 256417-10-4

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.1288

Ref: IN-DA00BDRW

2,6-Difluoro-4-methoxybenzaldehyde

CAS: 256417-10-4

2,6-Difluoro-4-methoxybenzaldehyde

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: faint gold solid

Molecular weight: 172.13g/mol

Ref: 54-PC9939

2,6-Difluoro-4-methoxybenzaldehyde

CAS: 256417-10-4

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Yellow to brown powder

Molecular weight: 172.131

Ref: 10-F033431