CAS 256427-77-7

4-phenyl-5-(trifluoromethyl)thiophen-3-amine

Description:

4-Phenyl-5-(trifluoromethyl)thiophen-3-amine is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a phenyl group and a trifluoromethyl group (–CF3) contributes to its unique chemical properties, including increased lipophilicity and potential for strong intermolecular interactions. This compound typically exhibits a solid state at room temperature and may have moderate solubility in organic solvents. The trifluoromethyl group is known for enhancing the compound's stability and influencing its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the amine functional group can participate in hydrogen bonding, which may affect its reactivity and interactions with biological targets. Overall, 4-phenyl-5-(trifluoromethyl)thiophen-3-amine is a compound of interest for its potential applications in pharmaceuticals and as a building block in organic synthesis.

Formula: C₁₁H₈F₃NS

InChI: InChI=1/C11H8F3NS/c12-11(13,14)10-9(8(15)6-16-10)7-4-2-1-3-5-7/h1-6H,15H2

SMILES: c1ccc(cc1)c1c(csc1C(F)(F)F)N

Synonyms:

• 3-Thiophenamine, 4-phenyl-5-(trifluoromethyl)-
• 4-Phenyl-5-(Trifluoromethyl)Thien-3-Ylamine
• 4-Phenyl-5-(trifluoromethyl)thiophen-3-amine

3-Amino-4-phenyl-5-(trifluoromethyl)thiophene

CAS: 256427-77-7

3-Amino-4-phenyl-5-(trifluoromethyl)thiophene

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 243.25g/mol

Ref: 54-PC11258

4-Phenyl-5-(trifluoromethyl)thiophen-3-amine

CAS: 256427-77-7

Purity: 98%

Molecular weight: 243.25

Ref: 10-F772343