CAS 25644-88-6
:3-(benzylsulfonyl)-L-alanine
Description:
3-(Benzylsulfonyl)-L-alanine is an organic compound characterized by the presence of a sulfonyl group attached to a benzyl moiety and an L-alanine backbone. This compound features a chiral center, which contributes to its potential biological activity and interactions. The sulfonyl group enhances the compound's solubility in polar solvents and may influence its reactivity and stability. Typically, compounds like this can exhibit properties such as being a potential inhibitor or modulator in biochemical pathways, making them of interest in medicinal chemistry. The presence of the benzyl group can also provide hydrophobic characteristics, which may affect the compound's interaction with biological membranes. Additionally, the amino acid structure allows for potential incorporation into peptides or proteins, which can be significant in drug design and development. Overall, 3-(benzylsulfonyl)-L-alanine is a compound of interest for its structural features and potential applications in pharmaceuticals and biochemistry.
Formula:C10H13NO4S
InChI:InChI=1/C10H13NO4S/c11-9(10(12)13)7-16(14,15)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1
SMILES:c1ccc(cc1)CS(=O)(=O)C[C@@H](C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
