CAS 25645-19-6
:Preisocalamendiol
Description:
Preisocalamendiol, with the CAS number 25645-19-6, is a chemical compound that belongs to the class of terpenoids, which are organic compounds produced by a variety of plants and are often characterized by their strong odors. This substance is typically derived from natural sources and may exhibit properties such as being a colorless to pale yellow liquid. Preisocalamendiol is known for its potential applications in the fragrance industry due to its pleasant scent profile. Additionally, it may possess biological activities, which could include antimicrobial or antifungal properties, making it of interest in pharmaceutical and cosmetic formulations. The compound's molecular structure features multiple chiral centers, contributing to its stereochemistry and influencing its reactivity and interactions with biological systems. As with many organic compounds, handling Preisocalamendiol requires standard safety precautions to avoid exposure, and its stability can be affected by environmental factors such as light and temperature. Further research may be necessary to fully elucidate its properties and potential applications.
Formula:C15H24O
InChI:InChI=1S/C15H24O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h6,11,14H,4-5,7-10H2,1-3H3/b12-6-/t14-/m0/s1
InChI key:InChIKey=QTFJNWQFKJITEE-ZDWRTJATSA-N
SMILES:C(C)(C)[C@H]1C(=O)CC(=C)CC\C=C(\C)/CC1
Synonyms:- (2S,5E)-5-Methyl-9-methylene-2-(1-methylethyl)-5-cyclodecen-1-one
- 5-Cyclodecen-1-one,5-methyl-9-methylene-2-(1-methylethyl)-, [S-(E)]-
- Germacra-1(10),4(15)-dien-6-one
- Germacra-1(10),4(15)-dien-6-one(8CI)
- Preisocalamendiol
- Preisocalamenediol
- 5-Cyclodecen-1-one, 5-methyl-9-methylene-2-(1-methylethyl)-, (2S,5E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Preisocalamendiol
CAS:Preisocalamendiol, a plausible precursor of isocalamendiol.Formula:C15H24OPurity:98%Color and Shape:SolidMolecular weight:220.35Preisocalamendiol
CAS:Preisocalamendiol is a synthetic compound, which is analogously designed to mimic natural neuromodulators found in the central nervous system. It is derived from laboratory synthesis techniques, which closely replicate certain endogenous molecules involved in neural communication. Its mode of action involves the modulation of ion channels, specifically targeting the regulation of calcium ion flow across neuronal membranes. By altering the opening and closing of these ion channels, Preisocalamendiol can influence neuronal excitability and neurotransmitter release, providing a valuable tool for studying synaptic transmission and neural circuitry.
Formula:C15H24OPurity:Min. 95%Molecular weight:220.35 g/mol


