CymitQuimica logo

CAS 2564798-15-6

:

Benzenamine, 4,4',4'',4''',4'''',4'''''-(9,10-dihydro-9,10[1',2']-benzenoanthracene-2,3,6,7,14,15-hexayl)hexakis[2,6-bis(1-methylethyl)-

Description:
Benzenamine, 4,4',4'',4''',4'''',4'''''-(9,10-dihydro-9,10[1',2']-benzenoanthracene-2,3,6,7,14,15-hexayl)hexakis[2,6-bis(1-methylethyl)- is a complex organic compound characterized by its intricate molecular structure, which includes multiple aromatic rings and substituents. This substance is likely to exhibit significant hydrophobic properties due to its extensive aromatic character, making it less soluble in polar solvents. The presence of multiple isopropyl groups suggests that it may have steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, the compound may display interesting electronic properties, potentially making it useful in applications such as organic electronics or photonics. Its synthesis and handling would require careful consideration of safety protocols, as many amines can be hazardous. Overall, this compound represents a unique class of organic materials with potential applications in advanced chemical and material science fields.
Formula:C92H116N6
InChI:InChI=1S/C92H116N6/c1-43(2)61-25-55(26-62(44(3)4)87(61)93)73-37-79-80(38-74(73)56-27-63(45(5)6)88(94)64(28-56)46(7)8)86-83-41-77(59-33-69(51(17)18)91(97)70(34-59)52(19)20)75(57-29-65(47(9)10)89(95)66(30-57)48(11)12)39-81(83)85(79)82-40-76(58-31-67(49(13)14)90(96)68(32-58)50(15)16)78(42-84(82)86)60-35-71(53(21)22)92(98)72(36-60)54(23)24/h25-54,85-86H,93-98H2,1-24H3
InChI key:VDQCYBNJDSUAPZ-UHFFFAOYSA-N
SMILES:CC(C)C1=CC(=CC(=C1N)C(C)C)C2=CC3=C(C=C2C4=CC(=C(C(=C4)C(C)C)N)C(C)C)C5C6=C(C3C7=C5C=C(C(=C7)C8=CC(=C(C(=C8)C(C)C)N)C(C)C)C9=CC(=C(C(=C9)C(C)C)N)C(C)C)C=C(C(=C6)C1=CC(=C(C(=C1)C(C)C)N)C(C)C)C1=CC(=C(C(=C1)C(C)C)N)C(C)C
Synonyms:
  • 4,4',4'',4''',4'''',4'''''-(9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,3,6,7,14,15-hexayl)hexakis(2,6-diisopropylaniline)
  • Benzenamine, 4,4',4'',4''',4'''',4'''''-(9,10-dihydro-9,10[1',2']-benzenoanthracene-2,3,6,7,14,15-hexayl)hexakis[2,6-bis(1-methylethyl)-
Found 2 products.