CAS 2565-01-7
:Nantenine
Description:
Nantenine is an alkaloid primarily derived from the plant species *Nandina domestica*, commonly known as heavenly bamboo. It is characterized by its complex structure, which includes a tetracyclic framework typical of many alkaloids. Nantenine exhibits a range of biological activities, including potential anti-inflammatory and neuroprotective effects, making it of interest in pharmacological research. The compound has been studied for its interactions with various neurotransmitter systems, particularly its affinity for serotonin receptors. Additionally, nantenine is known for its potential role in modulating the central nervous system, which may contribute to its therapeutic effects. Its chemical properties include solubility in organic solvents, and it may exhibit varying degrees of stability under different environmental conditions. As with many natural products, the extraction and purification of nantenine can be complex, often requiring specific methodologies to isolate it from plant matrices. Overall, nantenine represents a significant area of interest in natural product chemistry and pharmacology due to its diverse biological activities.
Formula:C20H21NO4
InChI:InChI=1S/C20H21NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1
InChI key:InChIKey=WSVWKHTVFGTTKJ-AWEZNQCLSA-N
SMILES:O(C)C1=C2C=3[C@](CC=4C2=CC5=C(C4)OCO5)(N(C)CCC3C=C1OC)[H]
Synonyms:- (S)-5,6,6a,7-Tetrahydro-1,2-dimethoxy-6-methyl-4H-benzo[de][1,3]benzodioxolo[5,6-g]quinolin
- 4H-benzo[de][1,3]benzodioxolo[5,6-g]quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (6aS)-
- 4H-Benzo[de][1,3]benzodioxolo[5,6-g]quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (6aS)-
- 4H-Benzo[de][1,3]benzodioxolo[5,6-g]quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (S)-
- 6a.alpha.-Aporphine, 1,2-dimethoxy-9,10-(methylenedioxy)-
- 6aα-Aporphine, 1,2-dimethoxy-9,10-(methylenedioxy)-
- Domesticine, O-methyl-
- Nantenine
- 4H-Benzo[de][1,3]benzodioxolo[5,6-g]quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4H-Benzo[de][1,3]benzodioxolo[5,6-g]quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl-, (6aS)-
CAS:Formula:C20H21NO4Color and Shape:SolidMolecular weight:339.3850Nantenine
CAS:<p>Nantenine inhibits acetylcholinesterase, blocks MDMA effects, has anticonvulsant properties, and is cytotoxic to SMMC-7721 cells (IC50 = 70.08 µM).</p>Formula:C20H21NO4Purity:98%Color and Shape:SolidMolecular weight:339.39O-Methyldomesticine
CAS:<p>O-Methyldomesticine is a type of alkaloid, which is a naturally occurring organic compound primarily found in certain plant species. These compounds often have complex structures and are typically derived from plant secondary metabolites. O-Methyldomesticine’s mode of action is thought to involve interactions with central nervous system receptors, although the precise mechanisms remain under investigation. Its chemical structure allows it to potentially modulate biochemical pathways, making it of interest to pharmacological research.</p>Formula:C20H21NO4Purity:Min. 95%Molecular weight:339.39 g/mol(S)-1,2-Dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-[1,3]dioxolo[4',5':4,5]benzo[1,2-g]benzo[de]quinoline
CAS:Controlled ProductFormula:C20H21NO4Color and Shape:NeatMolecular weight:339.4Nantenine
CAS:<p>Nantenine is an alkaloid, which is a naturally occurring compound found in certain plant species, particularly those in the Rutaceae family. This compound acts as an alpha-1 adrenergic receptor antagonist and a serotonergic receptor modulator, which means it can interfere with specific receptors involved in neurotransmission.</p>Formula:C20H21NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:339.4 g/molRef: 3D-CAA56501
Discontinued product




