CAS 256518-97-5

2-chloro-5-iodo-1H-benzimidazole

Description:

2-Chloro-5-iodo-1H-benzimidazole is a heterocyclic organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of chlorine and iodine substituents at the 2 and 5 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the biological activity often associated with halogenated benzimidazole derivatives. The presence of halogens can also influence the compound's electronic properties, making it a candidate for further chemical modifications. Additionally, 2-chloro-5-iodo-1H-benzimidazole may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₄ClIN₂

InChI: InChI=1/C7H4ClIN2/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H,(H,10,11)

SMILES: c1cc2c(cc1I)[nH]c(Cl)n2

Synonyms:

• 2-Chloro-5-iodo-1H-benzo[d]imidazole
• 1H-Benzimidazole, 2-chloro-5-iodo-

1H-BENZIMIDAZOLE, 2-CHLORO-5-IODO-

CAS: 256518-97-5

Formula: C₇H₄ClIN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 278.4775

Ref: IN-DA00BE48

2-Chloro-5-iodo-1H-benzo[d]imidazole

CAS: 256518-97-5

2-Chloro-5-iodo-1H-benzo[d]imidazole

Purity: 95%

Molecular weight: 278.48g/mol

Ref: 54-OR1001275

2-Chloro-5-iodo-1H-benzo[d]imidazole

CAS: 256518-97-5

Formula: C₇H₄ClIN₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 278.48

Ref: 10-F091802