CAS 25654-31-3: Cannabigerol
Description:Cannabigerol (CBG) is a non-psychoactive cannabinoid found in the cannabis plant, known for its potential therapeutic properties. It is often referred to as the "mother cannabinoid" because it serves as a precursor to other cannabinoids, including THC and CBD. CBG is typically present in lower concentrations compared to its more famous counterparts. The compound exhibits a range of potential health benefits, including anti-inflammatory, analgesic, and neuroprotective effects, making it a subject of interest in medical research. CBG interacts with the endocannabinoid system, influencing various physiological processes. Its chemical structure features a phenolic ring and a long hydrocarbon tail, contributing to its unique properties. CBG is generally considered safe, with a favorable safety profile, although more research is needed to fully understand its effects and potential applications. As interest in cannabinoids grows, CBG is gaining attention for its potential role in therapeutic formulations and as a natural alternative for various health conditions.
Formula:C21H32O2
InChI:InChI=1S/C21H32O2/c1-5-6-7-11-18-14-20(22)19(21(23)15-18)13-12-17(4)10-8-9-16(2)3/h9,12,14-15,22-23H,5-8,10-11,13H2,1-4H3/b17-12+
InChI key:InChIKey=QXACEHWTBCFNSA-SFQUDFHCSA-N
SMILES:OC=1C=C(C=C(O)C1CC=C(C)CCC=C(C)C)CCCCC
- Synonyms:
- (E)-2-(3,7-Dimethylocta-2,6-dien-1-yl)-5-pentylbenzene-1,3-diol
- 1,3-Benzenediol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-
- 1,3-Benzenediol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-, (E)-
- 1,3-Benzenediol, 2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-5-pentyl-
- 1,3-Benzenediol, 2-[(2E)-3,7-dimethyl-2,6-octadienyl]-5-pentyl-
- 2-((2E)-3,7-Dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol
- 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-pentyl-1,3-benzenediol
- Cannabigerol
- Resorcinol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-
- Resorcinol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-, (E)-
- See more synonyms
