CAS 25656-57-9
:Poly(diphenylamine)
Description:
Poly(diphenylamine) is a polymer derived from the polymerization of diphenylamine, characterized by its unique properties and applications. This substance typically exhibits good thermal stability and electrical conductivity, making it valuable in various industrial applications, particularly in the field of electronics and as an antioxidant in rubber and plastics. Poly(diphenylamine) is known for its ability to act as a charge transport material, which is beneficial in organic light-emitting diodes (OLEDs) and organic photovoltaic cells. Additionally, it possesses antioxidant properties, which help in preventing oxidative degradation in materials. The polymer is generally insoluble in water but may dissolve in organic solvents, depending on its molecular weight and structure. Its chemical structure features repeating diphenylamine units, contributing to its distinctive properties. Safety considerations should be taken into account when handling this substance, as it may pose health risks if inhaled or ingested. Overall, poly(diphenylamine) is a versatile material with significant potential in advanced material science and engineering applications.
Formula:(C12H11N)x
InChI:InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H
InChI key:InChIKey=DMBHHRLKUKUOEG-UHFFFAOYSA-N
SMILES:N(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Diphenylamine polymer
- Diphenylamine, polymers
- Poly(diphenylamine)
- Benzenamine, N-phenyl-, homopolymer
- Diphenylamine homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
