CymitQuimica logo

CAS 2565792-69-8

:

[S(R)]-N-[(S)-[3-(Benzyloxy)-2-(dicyclohexylphosphino)phenyl]-(2-naphthalenyl)methyl]-2-methyl-2-propanesulfinamide

Description:
The chemical substance with the name "[S(R)]-N-[(S)-[3-(Benzyloxy)-2-(dicyclohexylphosphino)phenyl]-(2-naphthalenyl)methyl]-2-methyl-2-propanesulfinamide" and CAS number "2565792-69-8" is a chiral sulfinamide compound, characterized by its complex structure that includes a sulfinamide functional group, a naphthalene moiety, and a benzyloxy group. This compound features a stereogenic center, which contributes to its chirality, making it potentially useful in asymmetric synthesis and catalysis. The presence of the dicyclohexylphosphino group suggests that it may have applications in organometallic chemistry or as a ligand in transition metal catalysis. The sulfinamide group is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, this compound's unique structural features and functional groups may provide valuable properties for applications in pharmaceuticals, materials science, and catalysis, although specific reactivity and application details would depend on further experimental studies.
Formula:C40H50NO2PS
InChI:InChI=1S/C40H50NO2PS/c1-40(2,3)45(42)41-38(33-27-26-31-18-13-14-19-32(31)28-33)36-24-15-25-37(43-29-30-16-7-4-8-17-30)39(36)44(34-20-9-5-10-21-34)35-22-11-6-12-23-35/h4,7-8,13-19,24-28,34-35,38,41H,5-6,9-12,20-23,29H2,1-3H3/t38-,45+/m0/s1
InChI key:WHSHRHFXMAHQQZ-RKNQDKJLSA-N
SMILES:CC(C)(C)[S@@](=O)N[C@@H](C1=CC2=CC=CC=C2C=C1)C3=C(C(=CC=C3)OCC4=CC=CC=C4)P(C5CCCCC5)C6CCCCC6
Found 3 products.