CAS 2566-89-4: Methyl arachidonate
Description:Methyl arachidonate is an ester derived from arachidonic acid, a polyunsaturated fatty acid that plays a crucial role in cellular signaling and inflammation. It is characterized by its long hydrocarbon chain, consisting of 20 carbon atoms and four double bonds, which contribute to its fluidity and reactivity. As a methyl ester, it has a methyl group attached to the carboxylic acid functional group of arachidonic acid, enhancing its solubility in organic solvents. Methyl arachidonate is often used in biochemical research to study lipid metabolism, signaling pathways, and the synthesis of eicosanoids, which are important mediators in inflammatory responses. Its properties include being a colorless to pale yellow liquid at room temperature, with a relatively low melting point due to its unsaturated nature. Additionally, it is sensitive to oxidation, which can affect its stability and reactivity. Overall, methyl arachidonate serves as a significant compound in both research and potential therapeutic applications related to inflammation and cell signaling.
Formula:C21H34O2
InChI:InChI=1S/C21H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-20H2,1-2H3/b8-7-,11-10-,14-13-,17-16-
InChI key:InChIKey=OFIDNKMQBYGNIW-ZKWNWVNESA-N
SMILES:O=C(OC)CCCC=CCC=CCC=CCC=CCCCCC
- Synonyms:
- 5,8,11,14-Eicosatetraenoic acid, methyl ester, (5Z,8Z,11Z,14Z)-
- 5,8,11,14-Eicosatetraenoic acid, methyl ester, (all-Z)-
- Arachidonic acid, methyl ester
- Methyl 5Z,8Z,11Z,14Z-eicosatetraenoate
- Methyl all-cis-5,8,11,14-eicosatetraenoate
- Methyl arachidonate
- Methyl cis,cis,cis,cis-eicosa-5,8,11,14-tetraenoate
