
CAS 25668-00-2
:p-Aminophenol homopolymer
Description:
p-Aminophenol homopolymer, identified by the CAS number 25668-00-2, is a synthetic polymer derived from the polymerization of p-aminophenol monomers. This substance exhibits several notable characteristics, including its solubility in water and organic solvents, which can vary depending on the degree of polymerization and the presence of functional groups. The polymer typically displays good thermal stability and can be processed into various forms, making it suitable for applications in coatings, adhesives, and as a dye intermediate. Additionally, p-aminophenol homopolymer possesses antioxidant properties, which can be beneficial in certain formulations. Its chemical structure, characterized by the presence of amino and hydroxyl groups, contributes to its reactivity and potential for further chemical modifications. Overall, p-aminophenol homopolymer is valued for its versatility in industrial applications, particularly in the fields of materials science and organic chemistry.
Formula:(C6H7NO)x
InChI:InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2
InChI key:InChIKey=PLIKAWJENQZMHA-UHFFFAOYSA-N
SMILES:NC1=CC=C(O)C=C1
Synonyms:- Phenol, p-amino-, polymers
- Poly(4-aminophenol)
- Phenol, 4-amino-, homopolymer
- Poly(p-aminophenol)
- p-Aminophenol homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
