CAS 2567-51-3
:2-Chloro-N,N-bis(phenylmethyl)acetamide
Description:
2-Chloro-N,N-bis(phenylmethyl)acetamide, with the CAS number 2567-51-3, is an organic compound characterized by its amide functional group and the presence of a chlorine atom. This compound features a central acetamide structure, where the nitrogen atom is substituted with two phenylmethyl groups, enhancing its lipophilicity and potentially influencing its biological activity. The chlorine substituent introduces additional reactivity and can affect the compound's solubility and stability. Typically, compounds of this nature may exhibit properties such as moderate to high melting points and solubility in organic solvents, depending on the specific interactions of the phenyl groups and the acetamide moiety. The presence of the chloro group may also impart unique chemical reactivity, making it a candidate for various synthetic applications or biological studies. Overall, 2-Chloro-N,N-bis(phenylmethyl)acetamide is of interest in fields such as medicinal chemistry and organic synthesis, where its structural features may be leveraged for developing new pharmaceuticals or chemical intermediates.
Formula:C16H16ClNO
InChI:InChI=1/C16H16ClNO/c17-11-16(19)18(12-14-7-3-1-4-8-14)13-15-9-5-2-6-10-15/h1-10H,11-13H2
InChI key:InChIKey=OVWIRORWDCWBCF-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C(CCl)=O
Synonyms:- 2-Chloro-N,N-bis(phenylmethyl)acetamide
- 2-Chloro-N,N-dibenzylacetamide
- Acetamide, N,N-dibenzyl-2-chloro-
- N,N-Dibenzylchloroacetamide
- NSC 2374
- acetamide, 2-chloro-N,N-bis(phenylmethyl)-
- N,N-Dibenzyl-2-chloroacetamide
- N,N-Dibenzyl-2-chloroacetamide
- N,N-Dibenzyl-2-chloro-acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.