CAS 25677-69-4
:2,9-diphenyl-1,10-phenanthroline
Description:
2,9-Diphenyl-1,10-phenanthroline, with the CAS number 25677-69-4, is an organic compound belonging to the phenanthroline family, characterized by its complex aromatic structure. This compound features two phenyl groups attached to the 2 and 9 positions of the phenanthroline core, which contributes to its unique electronic and optical properties. It is known for its chelating ability, particularly with transition metals, making it useful in coordination chemistry and analytical applications. The compound exhibits strong fluorescence and can be employed as a ligand in various metal complexes, enhancing their stability and reactivity. Additionally, 2,9-diphenyl-1,10-phenanthroline is often utilized in photochemical studies and as a probe in biological systems due to its ability to interact with DNA and other biomolecules. Its solubility in organic solvents and relatively low toxicity further enhance its applicability in research and industrial settings. Overall, this compound is significant in both theoretical and practical chemistry, particularly in the fields of materials science and biochemistry.
Formula:C24H16N2
InChI:InChI=1/C24H16N2/c1-3-7-17(8-4-1)21-15-13-19-11-12-20-14-16-22(18-9-5-2-6-10-18)26-24(20)23(19)25-21/h1-16H
SMILES:c1ccc(cc1)c1ccc2ccc3ccc(c4ccccc4)nc3c2n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,9-Diphenyl-1,10-phenanthroline
CAS:Formula:C24H16N2Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:332.412,9-Diphenyl-1,10-phenanthroline
CAS:Formula:C24H16N2Purity:98%Color and Shape:SolidMolecular weight:332.39722,9-Diphenyl-1,10-phenanthroline
CAS:2,9-Diphenyl-1,10-phenanthrolinePurity:99%Molecular weight:332.41g/mol2,9-Diphenyl-1,10-phenanthroline
CAS:2,9-Diphenyl-1,10-phenanthrolinePurity:99%Molecular weight:332.40g/mol2,9-Diphenyl-1,10-phenanthroline
CAS:<p>2,9-Diphenyl-1,10-phenanthroline is a yellow crystalline compound. This molecule has been shown to be an effective anticancer drug and is used in the study of ultrafast electron reduction. It exhibits photophysical properties that are dependent on its coordination geometry and the surrounding environment.<br>2,9-Diphenyl-1,10-phenanthroline is a coordination complex that can be synthesized by electropolymerization of copper complexes with phenanthrolines. The polymer film has been shown to have high stability constants and is resistant to water or organic solvents.</p>Formula:C24H16N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:332.4 g/mol





