CAS 25679-91-8

N-(butylcarbamoyl)-2-chloroacetamide

Description:

N-(butylcarbamoyl)-2-chloroacetamide, with the CAS number 25679-91-8, is a chemical compound that features a chloroacetamide functional group. This substance is characterized by its amide linkage, which is formed between a butyl group and a chloroacetyl moiety. The presence of the chlorine atom in the 2-position of the acetamide structure contributes to its reactivity and potential applications in various chemical reactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in polar solvents, and they may participate in nucleophilic substitution reactions due to the electrophilic nature of the chloro group. Additionally, the butyl group can influence the lipophilicity and overall stability of the compound. N-(butylcarbamoyl)-2-chloroacetamide may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data and handling precautions should be consulted due to the presence of chlorine and potential toxicity associated with amide compounds.

Formula: C₇H₁₃ClN₂O₂

InChI: InChI=1/C7H13ClN2O2/c1-2-3-4-9-7(12)10-6(11)5-8/h2-5H2,1H3,(H2,9,10,11,12)

Synonyms:

• N-[(butylamino)carbonyl]-2-chloroacetamide

1-Butyl-3-(2-chloroacetyl)urea

CAS: 25679-91-8

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 192.64 g/mol

Ref: 3D-ABA67991