CAS 25688-18-0

1-(3-Nitrophenyl)-1H-pyrazole

Description:

1-(3-Nitrophenyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two adjacent nitrogen atoms. The presence of a nitrophenyl group at the 1-position of the pyrazole contributes to its chemical reactivity and potential applications. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, reflecting its aromatic nature. It may display various functional properties, including potential biological activity, making it of interest in medicinal chemistry and agrochemical research. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and interactions with other molecules. Additionally, 1-(3-Nitrophenyl)-1H-pyrazole may undergo various chemical reactions, such as nucleophilic substitutions or reductions, depending on the conditions. Safety data should be consulted, as nitro compounds can pose health risks, and appropriate handling and disposal measures are essential in laboratory settings.

Formula: C₉H₇N₃O₂

InChI: InChI=1S/C9H7N3O2/c13-12(14)9-4-1-3-8(7-9)11-6-2-5-10-11/h1-7H

InChI key: InChIKey=WTFRZFHXSRGFQB-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1)N2C=CC=N2

Synonyms:

• 1H-Pyrazole, 1-(3-nitrophenyl)-
• Pyrazole, 1-(m-nitrophenyl)-
• 1-(3-Nitrophenyl)pyrazole
• 1-(m-Nitrophenyl)pyrazole
• 1-(3-Nitrophenyl)-1H-pyrazole

1-(3-Nitrophenyl)-1H-pyrazole

CAS: 25688-18-0

1-(3-Nitrophenyl)-1H-pyrazole

Purity: 95%

Molecular weight: 189.17g/mol

Ref: 54-OR932686

1-(3-Nitrophenyl)-1H-pyrazole

CAS: 25688-18-0

1-(3-Nitrophenyl)-1H-pyrazole is a small molecule inhibitor of p38 kinase. It can be used to treat arthritis and other diseases that are caused by the overactivation of p38 kinase. 1-(3-Nitrophenyl)-1H-pyrazole also has the potential to be used as a combinatorial library for the discovery of new inhibitors for protein kinases.

Formula: C₉H₇N₃O₂

Purity: Min. 95%

Molecular weight: 189.17 g/mol

Ref: 3D-ABA68818